C27H27ClFN3O5 — CID 123260011
8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(3-hydroxybutyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-ene]-1,5,7-trione (PubChem CID 123260011) has the molecular formula C27H27ClFN3O5 and a molecular weight of 527.98 g/mol. Its IUPAC name is 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(3-hydroxybutyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-ene]-1,5,7-trione.
| Compound Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(3-hydroxybutyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-ene]-1,5,7-trione |
|---|---|
| PubChem CID | 123260011 |
| Molecular Formula | C27H27ClFN3O5 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(3-hydroxybutyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-ene]-1,5,7-trione |
| SMILES | CC(O)CCN1C(=O)c2c3c(c(O)c(=O)n2C12CCC1C=CC12)C(=O)N(Cc1ccc(F)c(Cl)c1)CC3 |
| InChI | InChI=1S/C27H27ClFN3O5/c1-14(33)7-11-31-25(36)22-17-8-10-30(13-15-2-5-20(29)19(28)12-15)24(35)21(17)23(34)26(37)32(22)27(31)9-6-16-3-4-18(16)27/h2-5,12,14,16,18,33-34H,6-11,13H2,1H3 |
| InChIKey | GJANXLBEXLWRAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|