C22H23ClFN3O5 — CID 59344759
(11S)-5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-11-(hydroxymethyl)-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione (PubChem CID 59344759) has the molecular formula C22H23ClFN3O5 and a molecular weight of 463.89 g/mol. Its IUPAC name is (11S)-5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-11-(hydroxymethyl)-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione.
| Compound Name | (11S)-5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-11-(hydroxymethyl)-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
|---|---|
| PubChem CID | 59344759 |
| Molecular Formula | C22H23ClFN3O5 |
| Molecular Weight | 463.89 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (11S)-5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-11-(hydroxymethyl)-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
| SMILES | CN1CCC[C@@H](CO)n2c(c3c(c(O)c2=O)C(=O)N(Cc2ccc(F)c(Cl)c2)CC3)C1=O |
| InChI | InChI=1S/C22H23ClFN3O5/c1-25-7-2-3-13(11-28)27-18(21(25)31)14-6-8-26(20(30)17(14)19(29)22(27)32)10-12-4-5-16(24)15(23)9-12/h4-5,9,13,28-29H,2-3,6-8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | DNUAHJLXOLXWRS-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |