C17H16ClFN2O6S — CID 71455940
2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide (PubChem CID 71455940) has the molecular formula C17H16ClFN2O6S and a molecular weight of 430.84 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide |
|---|---|
| PubChem CID | 71455940 |
| Molecular Formula | C17H16ClFN2O6S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(O)c(O)c(O)c2c1CN(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C17H16ClFN2O6S/c1-20(2)28(26,27)16-9-7-21(6-8-3-4-11(19)10(18)5-8)17(25)12(9)13(22)14(23)15(16)24/h3-5,22-24H,6-7H2,1-2H3 |
| InChIKey | ZDODFLVJNKPLLD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|