C23H20ClFN2O5S — CID 71495836
2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-phenyl-3H-isoindole-4-sulfonamide (PubChem CID 71495836) has the molecular formula C23H20ClFN2O5S and a molecular weight of 490.94 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-phenyl-3H-isoindole-4-sulfonamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-phenyl-3H-isoindole-4-sulfonamide |
|---|---|
| PubChem CID | 71495836 |
| Molecular Formula | C23H20ClFN2O5S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-phenyl-3H-isoindole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c2c(c(O)c(O)c1-c1ccccc1)C(=O)N(Cc1ccc(F)c(Cl)c1)C2 |
| InChI | InChI=1S/C23H20ClFN2O5S/c1-26(2)33(31,32)22-15-12-27(11-13-8-9-17(25)16(24)10-13)23(30)19(15)21(29)20(28)18(22)14-6-4-3-5-7-14/h3-10,28-29H,11-12H2,1-2H3 |
| InChIKey | KMQLIYQRSSUEFV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|