C21H15ClFNO3 — CID 71461385
2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-5-phenyl-3H-isoindol-1-one (PubChem CID 71461385) has the molecular formula C21H15ClFNO3 and a molecular weight of 383.81 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-5-phenyl-3H-isoindol-1-one.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-5-phenyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 71461385 |
| Molecular Formula | C21H15ClFNO3 |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-5-phenyl-3H-isoindol-1-one |
| SMILES | O=C1c2c(cc(-c3ccccc3)c(O)c2O)CN1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClFNO3/c22-16-8-12(6-7-17(16)23)10-24-11-14-9-15(13-4-2-1-3-5-13)19(25)20(26)18(14)21(24)27/h1-9,25-26H,10-11H2 |
| InChIKey | IFZZAGRIRFOHGK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|