C15H12FNO3 — CID 16733372
2-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one (PubChem CID 16733372) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one.
| Compound Name | 2-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16733372 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2c(ccc(O)c2O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FNO3/c16-11-4-1-9(2-5-11)7-17-8-10-3-6-12(18)14(19)13(10)15(17)20/h1-6,18-19H,7-8H2 |
| InChIKey | XLAPRLGXHRZBNV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|