C19H13NO4 — CID 25196810
4,5-dihydroxy-2-(naphthalen-1-ylmethyl)isoindole-1,3-dione (PubChem CID 25196810) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 25196810 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(O)c(O)c2C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C19H13NO4/c21-15-9-8-14-16(17(15)22)19(24)20(18(14)23)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-9,21-22H,10H2 |
| InChIKey | GWAIVUYPBJLEOZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|