C14H17FN2O2 — CID 45269230
(4-fluorophenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate (PubChem CID 45269230) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is (4-fluorophenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate.
| Compound Name | (4-fluorophenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate |
|---|---|
| PubChem CID | 45269230 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (4-fluorophenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)N1CCN2CCC1CC2 |
| InChI | InChI=1S/C14H17FN2O2/c15-11-1-3-13(4-2-11)19-14(18)17-10-9-16-7-5-12(17)6-8-16/h1-4,12H,5-10H2 |
| InChIKey | UIEUWYVLTWWADX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |