(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate

C15H20N2O3 — CID 45272638

IUPAC(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate
SMILESCOc1ccc(OC(=O)N2CCN3CCC2CC3)cc1
InChIInChI=1S/C15H20N2O3/c1-19-13-2-4-14(5-3-13)20-15(18)17-11-10-16-8-6-12(17)7-9-16/h2-5,12H,6-11H2,1H3
InChIKeyDNXNMGVXLHOICO-UHFFFAOYSA-N
MW276.34 g/mol
LogP1.97
Rot. Bonds2

About (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate

(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate (PubChem CID 45272638) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate.

Molecular Properties

Compound Name(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate
PubChem CID45272638
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate
SMILESCOc1ccc(OC(=O)N2CCN3CCC2CC3)cc1
InChIInChI=1S/C15H20N2O3/c1-19-13-2-4-14(5-3-13)20-15(18)17-11-10-16-8-6-12(17)7-9-16/h2-5,12H,6-11H2,1H3
InChIKeyDNXNMGVXLHOICO-UHFFFAOYSA-N
XLogP1.97
TPSA42.01 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 51.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate?
The IUPAC name of (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate (CID 45272638) is (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate.
What is the SMILES notation for (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate?
The canonical SMILES for (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate is COc1ccc(OC(=O)N2CCN3CCC2CC3)cc1.
What is the InChIKey of (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate?
The InChIKey is DNXNMGVXLHOICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-19-13-2-4-14(5-3-13)20-15(18)17-11-10-16-8-6-12(17)7-9-16/h2-5,12H,6-11H2,1H3.
What are the key properties of (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate?
(4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate has a molecular weight of 276.34 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 1,4-diazabicyclo[3.2.2]nonane-4-carboxylate is sourced from PubChem (CID 45272638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).