C32H36FN3O5 — CID 118460276
1-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-2-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoethanone (PubChem CID 118460276) has the molecular formula C32H36FN3O5 and a molecular weight of 561.65 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-2-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoethanone.
| Compound Name | 1-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-2-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoethanone |
|---|---|
| PubChem CID | 118460276 |
| Molecular Formula | C32H36FN3O5 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 1-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-2-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoethanone |
| SMILES | C/N=C(/C(=O)N1CCN2CCC1CC2)c1cc(F)c(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C32H36FN3O5/c1-34-30(32(37)36-17-16-35-14-12-25(36)13-15-35)24-18-28(33)31(41-21-23-6-10-27(39-3)11-7-23)29(19-24)40-20-22-4-8-26(38-2)9-5-22/h4-11,18-19,25H,12-17,20-21H2,1-3H3/b34-30+ |
| InChIKey | WHCSQSLAGFBNCU-VBMGMRCRSA-N |
| XLogP | 4.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|