C30H33FN2O5 — CID 71259946
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]methanone (PubChem CID 71259946) has the molecular formula C30H33FN2O5 and a molecular weight of 520.60 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 71259946 |
| Molecular Formula | C30H33FN2O5 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-fluoro-4,5-bis[(4-methoxyphenyl)methoxy]phenyl]methanone |
| SMILES | COc1ccc(COc2cc(C(=O)N3CCN4CCC[C@H]4C3)cc(F)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H33FN2O5/c1-35-25-9-5-21(6-10-25)19-37-28-17-23(30(34)33-15-14-32-13-3-4-24(32)18-33)16-27(31)29(28)38-20-22-7-11-26(36-2)12-8-22/h5-12,16-17,24H,3-4,13-15,18-20H2,1-2H3/t24-/m0/s1 |
| InChIKey | JKBXXCUOASUHTH-DEOSSOPVSA-N |
| XLogP | 4.92 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |