C30H31FN2O4 — CID 123153445
2-[3-fluoro-4,5-bis(phenylmethoxy)phenyl]-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoacetamide (PubChem CID 123153445) has the molecular formula C30H31FN2O4 and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[3-fluoro-4,5-bis(phenylmethoxy)phenyl]-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoacetamide.
| Compound Name | 2-[3-fluoro-4,5-bis(phenylmethoxy)phenyl]-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 123153445 |
| Molecular Formula | C30H31FN2O4 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 2-[3-fluoro-4,5-bis(phenylmethoxy)phenyl]-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoacetamide |
| SMILES | CN1C2CCC1CC(NC(=O)C(=O)c1cc(F)c(OCc3ccccc3)c(OCc3ccccc3)c1)C2 |
| InChI | InChI=1S/C30H31FN2O4/c1-33-24-12-13-25(33)17-23(16-24)32-30(35)28(34)22-14-26(31)29(37-19-21-10-6-3-7-11-21)27(15-22)36-18-20-8-4-2-5-9-20/h2-11,14-15,23-25H,12-13,16-19H2,1H3,(H,32,35) |
| InChIKey | BNKAZGBPBVFIHD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|