C20H18BrN3 — CID 45271235
8-bromo-6-[(E)-4-pyridin-3-ylbut-1-enyl]naphthalene-2-carboximidamide (PubChem CID 45271235) has the molecular formula C20H18BrN3 and a molecular weight of 380.29 g/mol. Its IUPAC name is 8-bromo-6-[(E)-4-pyridin-3-ylbut-1-enyl]naphthalene-2-carboximidamide.
| Compound Name | 8-bromo-6-[(E)-4-pyridin-3-ylbut-1-enyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 45271235 |
| Molecular Formula | C20H18BrN3 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 8-bromo-6-[(E)-4-pyridin-3-ylbut-1-enyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(/C=C/CCc3cccnc3)cc(Br)c2c1 |
| InChI | InChI=1S/C20H18BrN3/c21-19-11-15(5-2-1-4-14-6-3-9-24-13-14)10-16-7-8-17(20(22)23)12-18(16)19/h2-3,5-13H,1,4H2,(H3,22,23)/b5-2+ |
| InChIKey | MKLZDVXXZNBUNB-GORDUTHDSA-N |
| XLogP | 4.93 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|