C17H12F4N4O — CID 45274467
4-[[5-amino-6-[2-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]phenol (PubChem CID 45274467) has the molecular formula C17H12F4N4O and a molecular weight of 364.30 g/mol. Its IUPAC name is 4-[[5-amino-6-[2-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-[[5-amino-6-[2-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 45274467 |
| Molecular Formula | C17H12F4N4O |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-[[5-amino-6-[2-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]phenol |
| SMILES | Nc1c(Nc2ccc(O)cc2)ncnc1-c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H12F4N4O/c18-13-7-9(17(19,20)21)1-6-12(13)15-14(22)16(24-8-23-15)25-10-2-4-11(26)5-3-10/h1-8,26H,22H2,(H,23,24,25) |
| InChIKey | FNWLMUPRTCEISI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|