C18H13F2NO3 — CID 45274855
2-[6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]acetic acid (PubChem CID 45274855) has the molecular formula C18H13F2NO3 and a molecular weight of 329.30 g/mol. Its IUPAC name is 2-[6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 45274855 |
| Molecular Formula | C18H13F2NO3 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2ccccc2F)c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C18H13F2NO3/c19-13-5-6-16-14(8-13)18(24)12(7-17(22)23)10-21(16)9-11-3-1-2-4-15(11)20/h1-6,8,10H,7,9H2,(H,22,23) |
| InChIKey | HIZIVQAOKUWJKR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |