C25H29N3O2 — CID 45275125
N-[[3-(aminomethyl)phenyl]methyl]-N-(cyclohexylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 45275125) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N-(cyclohexylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N-(cyclohexylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 45275125 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N-(cyclohexylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | NCc1cccc(CN(CC2CCCCC2)C(=O)C(=O)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C25H29N3O2/c26-14-19-9-6-10-20(13-19)17-28(16-18-7-2-1-3-8-18)25(30)24(29)22-15-27-23-12-5-4-11-21(22)23/h4-6,9-13,15,18,27H,1-3,7-8,14,16-17,26H2 |
| InChIKey | XOFYYNSZEAJSML-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|