C22H21N3O — CID 10132207
N-(2-aminoethyl)-N-(naphthalen-2-ylmethyl)-1H-indole-3-carboxamide (PubChem CID 10132207) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(naphthalen-2-ylmethyl)-1H-indole-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-(naphthalen-2-ylmethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 10132207 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-(2-aminoethyl)-N-(naphthalen-2-ylmethyl)-1H-indole-3-carboxamide |
| SMILES | NCCN(Cc1ccc2ccccc2c1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3O/c23-11-12-25(15-16-9-10-17-5-1-2-6-18(17)13-16)22(26)20-14-24-21-8-4-3-7-19(20)21/h1-10,13-14,24H,11-12,15,23H2 |
| InChIKey | NOTXYWDYLWWZMC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |