C15H14FN3O3S — CID 45278003
S-[[(5R)-3-(3-fluoro-4-pyrazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl] ethanethioate (PubChem CID 45278003) has the molecular formula C15H14FN3O3S and a molecular weight of 335.36 g/mol. Its IUPAC name is S-[[(5R)-3-(3-fluoro-4-pyrazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl] ethanethioate.
| Compound Name | S-[[(5R)-3-(3-fluoro-4-pyrazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 45278003 |
| Molecular Formula | C15H14FN3O3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | S-[[(5R)-3-(3-fluoro-4-pyrazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1CN(c2ccc(-n3cccn3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H14FN3O3S/c1-10(20)23-9-12-8-18(15(21)22-12)11-3-4-14(13(16)7-11)19-6-2-5-17-19/h2-7,12H,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | OUMWZUFEWYIZAI-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|