C15H18N4S — CID 45278943
2-cyclopropyl-6-(3,6-dihydro-2H-pyridin-1-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45278943) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-cyclopropyl-6-(3,6-dihydro-2H-pyridin-1-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-(3,6-dihydro-2H-pyridin-1-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 45278943 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-cyclopropyl-6-(3,6-dihydro-2H-pyridin-1-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(C2CC2)nc2sc(CN3CC=CCC3)cc12 |
| InChI | InChI=1S/C15H18N4S/c16-13-12-8-11(9-19-6-2-1-3-7-19)20-15(12)18-14(17-13)10-4-5-10/h1-2,8,10H,3-7,9H2,(H2,16,17,18) |
| InChIKey | YZRKAQUGJRMGDU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|