About 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine
6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 79969235) has the molecular formula C12H15N3OS2
and a molecular weight of 281.41 g/mol. Its IUPAC name is 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 79969235 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N)nc(C3CSCCO3)nc2s1 |
| InChI | InChI=1S/C12H15N3OS2/c1-2-7-5-8-10(13)14-11(15-12(8)18-7)9-6-17-4-3-16-9/h5,9H,2-4,6H2,1H3,(H2,13,14,15) |
| InChIKey | XJWZSWFEKWSPPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine (CID 79969235) is 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine is CCc1cc2c(N)nc(C3CSCCO3)nc2s1.
What is the InChIKey of 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is XJWZSWFEKWSPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS2/c1-2-7-5-8-10(13)14-11(15-12(8)18-7)9-6-17-4-3-16-9/h5,9H,2-4,6H2,1H3,(H2,13,14,15).
What are the key properties of 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine?
6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 281.41 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 79969235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).