C26H35N3S — CID 45281005
(5S)-5-benzyl-1-[[1-(4-phenylbutyl)piperidin-4-yl]methyl]imidazolidine-2-thione (PubChem CID 45281005) has the molecular formula C26H35N3S and a molecular weight of 421.65 g/mol. Its IUPAC name is (5S)-5-benzyl-1-[[1-(4-phenylbutyl)piperidin-4-yl]methyl]imidazolidine-2-thione.
| Compound Name | (5S)-5-benzyl-1-[[1-(4-phenylbutyl)piperidin-4-yl]methyl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 45281005 |
| Molecular Formula | C26H35N3S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (5S)-5-benzyl-1-[[1-(4-phenylbutyl)piperidin-4-yl]methyl]imidazolidine-2-thione |
| SMILES | S=C1NC[C@H](Cc2ccccc2)N1CC1CCN(CCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N3S/c30-26-27-20-25(19-23-12-5-2-6-13-23)29(26)21-24-14-17-28(18-15-24)16-8-7-11-22-9-3-1-4-10-22/h1-6,9-10,12-13,24-25H,7-8,11,14-21H2,(H,27,30)/t25-/m0/s1 |
| InChIKey | FDUYNNQAXBGUDS-VWLOTQADSA-N |
| XLogP | 4.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|