C18H24N2O2 — CID 73319659
6-benzyl-1-(cyclohexylmethyl)piperazine-2,3-dione (PubChem CID 73319659) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 6-benzyl-1-(cyclohexylmethyl)piperazine-2,3-dione.
| Compound Name | 6-benzyl-1-(cyclohexylmethyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 73319659 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 6-benzyl-1-(cyclohexylmethyl)piperazine-2,3-dione |
| SMILES | O=C1NCC(Cc2ccccc2)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C18H24N2O2/c21-17-18(22)20(13-15-9-5-2-6-10-15)16(12-19-17)11-14-7-3-1-4-8-14/h1,3-4,7-8,15-16H,2,5-6,9-13H2,(H,19,21) |
| InChIKey | SCEKHGFCEOZHCD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|