C26H42N4O4 — CID 53301784
1-(cyclohexylmethyl)-4-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione (PubChem CID 53301784) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione.
| Compound Name | 1-(cyclohexylmethyl)-4-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53301784 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione |
| SMILES | O=C1NC[C@@H](CCCCN2CCN(CC3CCCCC3)C(=O)C2=O)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C26H42N4O4/c31-23-24(32)30(19-21-11-5-2-6-12-21)22(17-27-23)13-7-8-14-28-15-16-29(26(34)25(28)33)18-20-9-3-1-4-10-20/h20-22H,1-19H2,(H,27,31)/t22-/m1/s1 |
| InChIKey | ABTCHBOOTPHOFH-JOCHJYFZSA-N |
| XLogP | 2.32 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|