C34H44N4O4 — CID 53299701
(5S)-4,5-dibenzyl-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione (PubChem CID 53299701) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is (5S)-4,5-dibenzyl-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione.
| Compound Name | (5S)-4,5-dibenzyl-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53299701 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | (5S)-4,5-dibenzyl-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]piperazine-2,3-dione |
| SMILES | O=C1NC[C@H](CCCCN2C[C@H](Cc3ccccc3)N(Cc3ccccc3)C(=O)C2=O)N(CCC2CCCCC2)C1=O |
| InChI | InChI=1S/C34H44N4O4/c39-31-32(40)37(21-19-26-12-4-1-5-13-26)29(23-35-31)18-10-11-20-36-25-30(22-27-14-6-2-7-15-27)38(34(42)33(36)41)24-28-16-8-3-9-17-28/h2-3,6-9,14-17,26,29-30H,1,4-5,10-13,18-25H2,(H,35,39)/t29-,30-/m0/s1 |
| InChIKey | ALPUZVHCLRNDDX-KYJUHHDHSA-N |
| XLogP | 3.94 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|