C31H40N4O5 — CID 53299710
(5S)-1-[4-[(2S)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]-5-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 53299710) has the molecular formula C31H40N4O5 and a molecular weight of 548.68 g/mol. Its IUPAC name is (5S)-1-[4-[(2S)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]-5-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (5S)-1-[4-[(2S)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]-5-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53299710 |
| Molecular Formula | C31H40N4O5 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (5S)-1-[4-[(2S)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]-5-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CN(CCCC[C@H]2CNC(=O)C(=O)N2Cc2ccccc2)C(=O)C(=O)N1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C31H40N4O5/c1-22(2)18-26-21-33(30(39)31(40)34(26)17-15-23-11-13-27(36)14-12-23)16-7-6-10-25-19-32-28(37)29(38)35(25)20-24-8-4-3-5-9-24/h3-5,8-9,11-14,22,25-26,36H,6-7,10,15-21H2,1-2H3,(H,32,37)/t25-,26-/m0/s1 |
| InChIKey | YZOCJUMMVIIHOM-UIOOFZCWSA-N |
| XLogP | 2.72 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|