C32H48N4O4 — CID 53301755
(5S)-4-(2-cyclohexylethyl)-1-[4-[(2R)-5,6-dioxo-1-(2-phenylethyl)piperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 53301755) has the molecular formula C32H48N4O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is (5S)-4-(2-cyclohexylethyl)-1-[4-[(2R)-5,6-dioxo-1-(2-phenylethyl)piperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (5S)-4-(2-cyclohexylethyl)-1-[4-[(2R)-5,6-dioxo-1-(2-phenylethyl)piperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53301755 |
| Molecular Formula | C32H48N4O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | (5S)-4-(2-cyclohexylethyl)-1-[4-[(2R)-5,6-dioxo-1-(2-phenylethyl)piperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CN(CCCC[C@@H]2CNC(=O)C(=O)N2CCc2ccccc2)C(=O)C(=O)N1CCC1CCCCC1 |
| InChI | InChI=1S/C32H48N4O4/c1-24(2)21-28-23-34(31(39)32(40)36(28)20-17-26-13-7-4-8-14-26)18-10-9-15-27-22-33-29(37)30(38)35(27)19-16-25-11-5-3-6-12-25/h3,5-6,11-12,24,26-28H,4,7-10,13-23H2,1-2H3,(H,33,37)/t27-,28+/m1/s1 |
| InChIKey | UWUIUURCYFUHCZ-IZLXSDGUSA-N |
| XLogP | 3.78 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|