C35H46N4O6 — CID 53300322
(5S)-4-(2-cyclohexylethyl)-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-[(4-hydroxyphenyl)methyl]piperazine-2,3-dione (PubChem CID 53300322) has the molecular formula C35H46N4O6 and a molecular weight of 618.78 g/mol. Its IUPAC name is (5S)-4-(2-cyclohexylethyl)-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-[(4-hydroxyphenyl)methyl]piperazine-2,3-dione.
| Compound Name | (5S)-4-(2-cyclohexylethyl)-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-[(4-hydroxyphenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53300322 |
| Molecular Formula | C35H46N4O6 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | (5S)-4-(2-cyclohexylethyl)-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-[(4-hydroxyphenyl)methyl]piperazine-2,3-dione |
| SMILES | O=C1NC[C@H](CCCCN2C[C@H](Cc3ccc(O)cc3)N(CCC3CCCCC3)C(=O)C2=O)N(CCc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C35H46N4O6/c40-30-13-9-26(10-14-30)18-20-38-28(23-36-32(42)33(38)43)8-4-5-19-37-24-29(22-27-11-15-31(41)16-12-27)39(35(45)34(37)44)21-17-25-6-2-1-3-7-25/h9-16,25,28-29,40-41H,1-8,17-24H2,(H,36,42)/t28-,29-/m0/s1 |
| InChIKey | YACRYTQLPVNULP-VMPREFPWSA-N |
| XLogP | 3.39 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|