C27H38N4O4 — CID 53301782
1-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(2-phenylethyl)piperazine-2,3-dione (PubChem CID 53301782) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(2-phenylethyl)piperazine-2,3-dione.
| Compound Name | 1-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(2-phenylethyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53301782 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 1-[4-[(2R)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(2-phenylethyl)piperazine-2,3-dione |
| SMILES | O=C1NC[C@@H](CCCCN2CCN(CCc3ccccc3)C(=O)C2=O)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C27H38N4O4/c32-24-25(33)31(20-22-11-5-2-6-12-22)23(19-28-24)13-7-8-15-29-17-18-30(27(35)26(29)34)16-14-21-9-3-1-4-10-21/h1,3-4,9-10,22-23H,2,5-8,11-20H2,(H,28,32)/t23-/m1/s1 |
| InChIKey | SUTNCHGRXNHYIH-HSZRJFAPSA-N |
| XLogP | 1.98 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|