C31H35N3O2 — CID 45281007
(6S)-6-benzyl-1-[[1-[2-(4-phenylphenyl)ethyl]piperidin-4-yl]methyl]piperazine-2,3-dione (PubChem CID 45281007) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is (6S)-6-benzyl-1-[[1-[2-(4-phenylphenyl)ethyl]piperidin-4-yl]methyl]piperazine-2,3-dione.
| Compound Name | (6S)-6-benzyl-1-[[1-[2-(4-phenylphenyl)ethyl]piperidin-4-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 45281007 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (6S)-6-benzyl-1-[[1-[2-(4-phenylphenyl)ethyl]piperidin-4-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1NC[C@H](Cc2ccccc2)N(CC2CCN(CCc3ccc(-c4ccccc4)cc3)CC2)C1=O |
| InChI | InChI=1S/C31H35N3O2/c35-30-31(36)34(29(22-32-30)21-25-7-3-1-4-8-25)23-26-16-19-33(20-17-26)18-15-24-11-13-28(14-12-24)27-9-5-2-6-10-27/h1-14,26,29H,15-23H2,(H,32,35)/t29-/m0/s1 |
| InChIKey | FMOJCCKJBLMONL-LJAQVGFWSA-N |
| XLogP | 4.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|