C19H20FN3O2 — CID 101155743
7-benzyl-1-[2-(4-fluorophenyl)ethyl]-1,3,5-triazepane-2,4-dione (PubChem CID 101155743) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 7-benzyl-1-[2-(4-fluorophenyl)ethyl]-1,3,5-triazepane-2,4-dione.
| Compound Name | 7-benzyl-1-[2-(4-fluorophenyl)ethyl]-1,3,5-triazepane-2,4-dione |
|---|---|
| PubChem CID | 101155743 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 7-benzyl-1-[2-(4-fluorophenyl)ethyl]-1,3,5-triazepane-2,4-dione |
| SMILES | O=C1NCC(Cc2ccccc2)N(CCc2ccc(F)cc2)C(=O)N1 |
| InChI | InChI=1S/C19H20FN3O2/c20-16-8-6-14(7-9-16)10-11-23-17(12-15-4-2-1-3-5-15)13-21-18(24)22-19(23)25/h1-9,17H,10-13H2,(H2,21,22,24,25) |
| InChIKey | XCPROTTTZNYCAS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |