C25H29N3O2 — CID 71762950
(5S,8aS)-5-benzyl-1-(2-phenylethyl)spiro[5,7,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,1'-cyclopentane]-2,6-dione (PubChem CID 71762950) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (5S,8aS)-5-benzyl-1-(2-phenylethyl)spiro[5,7,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,1'-cyclopentane]-2,6-dione.
| Compound Name | (5S,8aS)-5-benzyl-1-(2-phenylethyl)spiro[5,7,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,1'-cyclopentane]-2,6-dione |
|---|---|
| PubChem CID | 71762950 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (5S,8aS)-5-benzyl-1-(2-phenylethyl)spiro[5,7,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,1'-cyclopentane]-2,6-dione |
| SMILES | O=C1NC[C@@H]2N(CCc3ccccc3)C(=O)C3(CCCC3)N2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c29-23-21(17-20-11-5-2-6-12-20)28-22(18-26-23)27(16-13-19-9-3-1-4-10-19)24(30)25(28)14-7-8-15-25/h1-6,9-12,21-22H,7-8,13-18H2,(H,26,29)/t21-,22+/m0/s1 |
| InChIKey | SNWJAYDZQJTXMK-FCHUYYIVSA-N |
| XLogP | 2.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |