C16H23N3O2 — CID 101155739
7-butyl-1-(2-phenylethyl)-1,3,5-triazepane-2,4-dione (PubChem CID 101155739) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 7-butyl-1-(2-phenylethyl)-1,3,5-triazepane-2,4-dione.
| Compound Name | 7-butyl-1-(2-phenylethyl)-1,3,5-triazepane-2,4-dione |
|---|---|
| PubChem CID | 101155739 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 7-butyl-1-(2-phenylethyl)-1,3,5-triazepane-2,4-dione |
| SMILES | CCCCC1CNC(=O)NC(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-3-9-14-12-17-15(20)18-16(21)19(14)11-10-13-7-5-4-6-8-13/h4-8,14H,2-3,9-12H2,1H3,(H2,17,18,20,21) |
| InChIKey | HSEFJEHMGYBLQS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |