C16H22FN3O2 — CID 73319651
6-(4-aminobutyl)-1-[2-(3-fluorophenyl)ethyl]piperazine-2,3-dione (PubChem CID 73319651) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 6-(4-aminobutyl)-1-[2-(3-fluorophenyl)ethyl]piperazine-2,3-dione.
| Compound Name | 6-(4-aminobutyl)-1-[2-(3-fluorophenyl)ethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 73319651 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 6-(4-aminobutyl)-1-[2-(3-fluorophenyl)ethyl]piperazine-2,3-dione |
| SMILES | NCCCCC1CNC(=O)C(=O)N1CCc1cccc(F)c1 |
| InChI | InChI=1S/C16H22FN3O2/c17-13-5-3-4-12(10-13)7-9-20-14(6-1-2-8-18)11-19-15(21)16(20)22/h3-5,10,14H,1-2,6-9,11,18H2,(H,19,21) |
| InChIKey | AOHDVPPKHMBOEK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|