C27H32N4O5 — CID 53301819
1-[4-[(2R)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]piperazine-2,3-dione (PubChem CID 53301819) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 1-[4-[(2R)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]piperazine-2,3-dione.
| Compound Name | 1-[4-[(2R)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53301819 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[4-[(2R)-1-benzyl-5,6-dioxopiperazin-2-yl]butyl]-4-[2-(4-hydroxyphenyl)ethyl]piperazine-2,3-dione |
| SMILES | O=C1NC[C@@H](CCCCN2CCN(CCc3ccc(O)cc3)C(=O)C2=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H32N4O5/c32-23-11-9-20(10-12-23)13-15-30-17-16-29(26(35)27(30)36)14-5-4-8-22-18-28-24(33)25(34)31(22)19-21-6-2-1-3-7-21/h1-3,6-7,9-12,22,32H,4-5,8,13-19H2,(H,28,33)/t22-/m1/s1 |
| InChIKey | GSAMQKRNDJPKMM-JOCHJYFZSA-N |
| XLogP | 1.30 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|