C32H42N4O6 — CID 53300331
(5S)-4-[2-(4-hydroxyphenyl)ethyl]-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 53300331) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is (5S)-4-[2-(4-hydroxyphenyl)ethyl]-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (5S)-4-[2-(4-hydroxyphenyl)ethyl]-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53300331 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (5S)-4-[2-(4-hydroxyphenyl)ethyl]-1-[4-[(2S)-1-[2-(4-hydroxyphenyl)ethyl]-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CN(CCCC[C@H]2CNC(=O)C(=O)N2CCc2ccc(O)cc2)C(=O)C(=O)N1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C32H42N4O6/c1-22(2)19-26-21-34(31(41)32(42)36(26)18-15-24-8-12-28(38)13-9-24)16-4-3-5-25-20-33-29(39)30(40)35(25)17-14-23-6-10-27(37)11-7-23/h6-13,22,25-26,37-38H,3-5,14-21H2,1-2H3,(H,33,39)/t25-,26-/m0/s1 |
| InChIKey | RAYAYASTGKMCOT-UIOOFZCWSA-N |
| XLogP | 2.47 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|