C30H50N4O4 — CID 53299685
(5S)-4-(cyclohexylmethyl)-1-[4-[(2S)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 53299685) has the molecular formula C30H50N4O4 and a molecular weight of 530.75 g/mol. Its IUPAC name is (5S)-4-(cyclohexylmethyl)-1-[4-[(2S)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (5S)-4-(cyclohexylmethyl)-1-[4-[(2S)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53299685 |
| Molecular Formula | C30H50N4O4 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | (5S)-4-(cyclohexylmethyl)-1-[4-[(2S)-1-(cyclohexylmethyl)-5,6-dioxopiperazin-2-yl]butyl]-5-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CN(CCCC[C@H]2CNC(=O)C(=O)N2CC2CCCCC2)C(=O)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C30H50N4O4/c1-22(2)17-26-21-32(29(37)30(38)34(26)20-24-13-7-4-8-14-24)16-10-9-15-25-18-31-27(35)28(36)33(25)19-23-11-5-3-6-12-23/h22-26H,3-21H2,1-2H3,(H,31,35)/t25-,26-/m0/s1 |
| InChIKey | BPRFYOPUSRTEBL-UIOOFZCWSA-N |
| XLogP | 3.73 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|