C23H22N2O3 — CID 73319664
6-[(4-hydroxyphenyl)methyl]-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione (PubChem CID 73319664) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-[(4-hydroxyphenyl)methyl]-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione.
| Compound Name | 6-[(4-hydroxyphenyl)methyl]-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 73319664 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 6-[(4-hydroxyphenyl)methyl]-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione |
| SMILES | O=C1NCC(Cc2ccc(O)cc2)N(CCc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C23H22N2O3/c26-20-10-8-16(9-11-20)14-19-15-24-22(27)23(28)25(19)13-12-18-6-3-5-17-4-1-2-7-21(17)18/h1-11,19,26H,12-15H2,(H,24,27) |
| InChIKey | JDNSDTOPXLFFFM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|