C18H20N2O3 — CID 16745905
(6R)-6-(1-hydroxyethyl)-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione (PubChem CID 16745905) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (6R)-6-(1-hydroxyethyl)-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione.
| Compound Name | (6R)-6-(1-hydroxyethyl)-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 16745905 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (6R)-6-(1-hydroxyethyl)-1-(2-naphthalen-1-ylethyl)piperazine-2,3-dione |
| SMILES | CC(O)[C@H]1CNC(=O)C(=O)N1CCc1cccc2ccccc12 |
| InChI | InChI=1S/C18H20N2O3/c1-12(21)16-11-19-17(22)18(23)20(16)10-9-14-7-4-6-13-5-2-3-8-15(13)14/h2-8,12,16,21H,9-11H2,1H3,(H,19,22)/t12?,16-/m1/s1 |
| InChIKey | PASRXHJBZXVUGG-PVQCJRHBSA-N |
| XLogP | 1.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|