C18H22O3 — CID 174514046
2-hydroxy-4,4-dimethyl-6-naphthalen-1-ylhexanoic acid (PubChem CID 174514046) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-hydroxy-4,4-dimethyl-6-naphthalen-1-ylhexanoic acid.
| Compound Name | 2-hydroxy-4,4-dimethyl-6-naphthalen-1-ylhexanoic acid |
|---|---|
| PubChem CID | 174514046 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-hydroxy-4,4-dimethyl-6-naphthalen-1-ylhexanoic acid |
| SMILES | CC(C)(CCc1cccc2ccccc12)CC(O)C(=O)O |
| InChI | InChI=1S/C18H22O3/c1-18(2,12-16(19)17(20)21)11-10-14-8-5-7-13-6-3-4-9-15(13)14/h3-9,16,19H,10-12H2,1-2H3,(H,20,21) |
| InChIKey | KXHSVHSLSTYXEN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |