C44H44N2O4 — CID 57113152
bis[1-(dimethylamino)-3-naphthalen-1-yl-1-phenylpropyl] oxalate (PubChem CID 57113152) has the molecular formula C44H44N2O4 and a molecular weight of 664.85 g/mol. Its IUPAC name is bis[1-(dimethylamino)-3-naphthalen-1-yl-1-phenylpropyl] oxalate.
| Compound Name | bis[1-(dimethylamino)-3-naphthalen-1-yl-1-phenylpropyl] oxalate |
|---|---|
| PubChem CID | 57113152 |
| Molecular Formula | C44H44N2O4 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | bis[1-(dimethylamino)-3-naphthalen-1-yl-1-phenylpropyl] oxalate |
| SMILES | CN(C)C(CCc1cccc2ccccc12)(OC(=O)C(=O)OC(CCc1cccc2ccccc12)(c1ccccc1)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C44H44N2O4/c1-45(2)43(37-23-7-5-8-24-37,31-29-35-21-15-19-33-17-11-13-27-39(33)35)49-41(47)42(48)50-44(46(3)4,38-25-9-6-10-26-38)32-30-36-22-16-20-34-18-12-14-28-40(34)36/h5-28H,29-32H2,1-4H3 |
| InChIKey | DPNDKPPJDHWUPP-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|