C43H45NO4 — CID 5368671
2-phenylpropan-2-yl 2-[(E)-4-(dibenzylamino)-5-phenyl-5-phenylmethoxypent-2-enoxy]acetate (PubChem CID 5368671) has the molecular formula C43H45NO4 and a molecular weight of 639.84 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-[(E)-4-(dibenzylamino)-5-phenyl-5-phenylmethoxypent-2-enoxy]acetate.
| Compound Name | 2-phenylpropan-2-yl 2-[(E)-4-(dibenzylamino)-5-phenyl-5-phenylmethoxypent-2-enoxy]acetate |
|---|---|
| PubChem CID | 5368671 |
| Molecular Formula | C43H45NO4 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 2-phenylpropan-2-yl 2-[(E)-4-(dibenzylamino)-5-phenyl-5-phenylmethoxypent-2-enoxy]acetate |
| SMILES | CC(C)(OC(=O)COC/C=C/C(C(OCc1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H45NO4/c1-43(2,39-27-16-7-17-28-39)48-41(45)34-46-30-18-29-40(42(38-25-14-6-15-26-38)47-33-37-23-12-5-13-24-37)44(31-35-19-8-3-9-20-35)32-36-21-10-4-11-22-36/h3-29,40,42H,30-34H2,1-2H3/b29-18+ |
| InChIKey | DPUOSAXHGDLCPU-RDRPBHBLSA-N |
| XLogP | 9.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|