C42H48N2O4 — CID 56975510
bis[2-[2-(dimethylamino)ethyl]-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl] oxalate (PubChem CID 56975510) has the molecular formula C42H48N2O4 and a molecular weight of 644.86 g/mol. Its IUPAC name is bis[2-[2-(dimethylamino)ethyl]-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl] oxalate.
| Compound Name | bis[2-[2-(dimethylamino)ethyl]-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl] oxalate |
|---|---|
| PubChem CID | 56975510 |
| Molecular Formula | C42H48N2O4 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | bis[2-[2-(dimethylamino)ethyl]-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl] oxalate |
| SMILES | CN(C)CCC1CCc2ccccc2C1(OC(=O)C(=O)OC1(c2ccccc2)c2ccccc2CCC1CCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C42H48N2O4/c1-43(2)29-27-35-25-23-31-15-11-13-21-37(31)41(35,33-17-7-5-8-18-33)47-39(45)40(46)48-42(34-19-9-6-10-20-34)36(28-30-44(3)4)26-24-32-16-12-14-22-38(32)42/h5-22,35-36H,23-30H2,1-4H3 |
| InChIKey | UTYQOUNYHRTHNU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|