C19H17N3O6 — CID 45281360
N'-[2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]-2-oxo-1H-pyridine-3-carbohydrazide (PubChem CID 45281360) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is N'-[2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]-2-oxo-1H-pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]-2-oxo-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 45281360 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N'-[2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]-2-oxo-1H-pyridine-3-carbohydrazide |
| SMILES | Cc1cc(=O)oc2cc(OC(C)C(=O)NNC(=O)c3ccc[nH]c3=O)ccc12 |
| InChI | InChI=1S/C19H17N3O6/c1-10-8-16(23)28-15-9-12(5-6-13(10)15)27-11(2)17(24)21-22-19(26)14-4-3-7-20-18(14)25/h3-9,11H,1-2H3,(H,20,25)(H,21,24)(H,22,26) |
| InChIKey | YHDYUMVICOCVPX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|