C11H17F4NO3 — CID 45283104
7-(2,2,3,3-tetrafluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 45283104) has the molecular formula C11H17F4NO3 and a molecular weight of 287.25 g/mol. Its IUPAC name is 7-(2,2,3,3-tetrafluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(2,2,3,3-tetrafluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 45283104 |
| Molecular Formula | C11H17F4NO3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 7-(2,2,3,3-tetrafluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1OCC(F)(F)C(F)F)OCCO2 |
| InChI | InChI=1S/C11H17F4NO3/c12-9(13)11(14,15)6-17-8-5-10(2-1-7(8)16)18-3-4-19-10/h7-9H,1-6,16H2 |
| InChIKey | IRRSIYWGZYJPCS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|