C8H18ClN — CID 45286057
N,3-dimethylcyclohexan-1-amine;hydrochloride (PubChem CID 45286057) has the molecular formula C8H18ClN and a molecular weight of 163.69 g/mol. Its IUPAC name is N,3-dimethylcyclohexan-1-amine;hydrochloride.
| Compound Name | N,3-dimethylcyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 45286057 |
| Molecular Formula | C8H18ClN |
| Molecular Weight | 163.69 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N,3-dimethylcyclohexan-1-amine;hydrochloride |
| SMILES | CNC1CCCC(C)C1.Cl |
| InChI | InChI=1S/C8H17N.ClH/c1-7-4-3-5-8(6-7)9-2;/h7-9H,3-6H2,1-2H3;1H |
| InChIKey | AIQOLFRXKSYEQY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |