C25H29N3O5S — CID 45339901
(2S)-2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 45339901) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is (2S)-2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 45339901 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (2S)-2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c1-28(19-7-3-2-4-8-19)34(32,33)20-13-11-17(12-14-20)24(29)27-23(25(30)31)15-18-16-26-22-10-6-5-9-21(18)22/h5-6,9-14,16,19,23,26H,2-4,7-8,15H2,1H3,(H,27,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | OZJZZTSTRPPNSU-QHCPKHFHSA-N |
| XLogP | 3.55 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |