C20H29N3O7S2 — CID 45353788
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpiperidine-4-carbohydrazide (PubChem CID 45353788) has the molecular formula C20H29N3O7S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpiperidine-4-carbohydrazide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 45353788 |
| Molecular Formula | C20H29N3O7S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpiperidine-4-carbohydrazide |
| SMILES | CN(C)N(C(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H29N3O7S2/c1-21(2)23(16-7-12-31(25,26)14-16)20(24)15-5-8-22(9-6-15)32(27,28)17-3-4-18-19(13-17)30-11-10-29-18/h3-4,13,15-16H,5-12,14H2,1-2H3 |
| InChIKey | BZHYLNFOOUPDDO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|