C28H24N2O4 — CID 45357261
2-(9H-fluorene-9-carbonyloxymethylamino)-3-(4-pyrrol-1-ylphenyl)propanoic acid (PubChem CID 45357261) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-(9H-fluorene-9-carbonyloxymethylamino)-3-(4-pyrrol-1-ylphenyl)propanoic acid.
| Compound Name | 2-(9H-fluorene-9-carbonyloxymethylamino)-3-(4-pyrrol-1-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 45357261 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-(9H-fluorene-9-carbonyloxymethylamino)-3-(4-pyrrol-1-ylphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(-n2cccc2)cc1)NCOC(=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H24N2O4/c31-27(32)25(17-19-11-13-20(14-12-19)30-15-5-6-16-30)29-18-34-28(33)26-23-9-3-1-7-21(23)22-8-2-4-10-24(22)26/h1-16,25-26,29H,17-18H2,(H,31,32) |
| InChIKey | BUPMPUIFEBBCGO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|