C10H14Cl2FN5 — CID 45357279
2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]guanidine;dihydrochloride (PubChem CID 45357279) has the molecular formula C10H14Cl2FN5 and a molecular weight of 294.16 g/mol. Its IUPAC name is 2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]guanidine;dihydrochloride.
| Compound Name | 2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 45357279 |
| Molecular Formula | C10H14Cl2FN5 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C10H12FN5.2ClH/c11-6-1-2-7-8(5-6)16-9(15-7)3-4-14-10(12)13;;/h1-2,5H,3-4H2,(H,15,16)(H4,12,13,14);2*1H |
| InChIKey | WRHHLHRYJGOHHY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|