C23H21NaO8 — CID 45357799
sodium 2,6-bis(3,5-dimethoxyphenoxy)benzoate (PubChem CID 45357799) has the molecular formula C23H21NaO8 and a molecular weight of 448.40 g/mol. Its IUPAC name is sodium 2,6-bis(3,5-dimethoxyphenoxy)benzoate.
| Compound Name | sodium 2,6-bis(3,5-dimethoxyphenoxy)benzoate |
|---|---|
| PubChem CID | 45357799 |
| Molecular Formula | C23H21NaO8 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | sodium 2,6-bis(3,5-dimethoxyphenoxy)benzoate |
| SMILES | COc1cc(OC)cc(Oc2cccc(Oc3cc(OC)cc(OC)c3)c2C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C23H22O8.Na/c1-26-14-8-15(27-2)11-18(10-14)30-20-6-5-7-21(22(20)23(24)25)31-19-12-16(28-3)9-17(13-19)29-4;/h5-13H,1-4H3,(H,24,25);/q;+1/p-1 |
| InChIKey | OFSPDEXUSWFNFJ-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |